C29H39N3O5 — CID 143672584
trans-(1S,3S)-3-(2-ethoxy-7-methoxyquinolin-4-yl)oxy-N-[(1R,2S)-2-[(Z)-6-[formyl(methyl)amino]hex-1-enyl]cyclopropyl]cyclopentane-1-carboxamide (PubChem CID 143672584) has the molecular formula C29H39N3O5 and a molecular weight of 509.65 g/mol. Its IUPAC name is trans-(1S,3S)-3-(2-ethoxy-7-methoxyquinolin-4-yl)oxy-N-[(1R,2S)-2-[(Z)-6-[formyl(methyl)amino]hex-1-enyl]cyclopropyl]cyclopentane-1-carboxamide.
| Compound Name | trans-(1S,3S)-3-(2-ethoxy-7-methoxyquinolin-4-yl)oxy-N-[(1R,2S)-2-[(Z)-6-[formyl(methyl)amino]hex-1-enyl]cyclopropyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 143672584 |
| Molecular Formula | C29H39N3O5 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | trans-(1S,3S)-3-(2-ethoxy-7-methoxyquinolin-4-yl)oxy-N-[(1R,2S)-2-[(Z)-6-[formyl(methyl)amino]hex-1-enyl]cyclopropyl]cyclopentane-1-carboxamide |
| SMILES | CCOc1cc(O[C@H]2CC[C@H](C(=O)N[C@@H]3C[C@H]3/C=C\CCCCN(C)C=O)C2)c2ccc(OC)cc2n1 |
| InChI | InChI=1S/C29H39N3O5/c1-4-36-28-18-27(24-13-12-22(35-3)17-26(24)30-28)37-23-11-10-21(15-23)29(34)31-25-16-20(25)9-7-5-6-8-14-32(2)19-33/h7,9,12-13,17-21,23,25H,4-6,8,10-11,14-16H2,1-3H3,(H,31,34)/b9-7-/t20-,21+,23+,25-/m1/s1 |
| InChIKey | CUZFGHLRQOICIA-CBYFMQNHSA-N |
| XLogP | 4.51 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|