C41H59N3O6S — CID 143401223
(Z)-1-(2-acetylpyrrolidin-1-yl)-9-[(1R)-2-propylcyclopropyl]non-8-en-1-one;2-(4,7-dimethoxyquinolin-2-yl)-4-propan-2-yl-1,3-thiazole;ethyl formate (PubChem CID 143401223) has the molecular formula C41H59N3O6S and a molecular weight of 722.01 g/mol. Its IUPAC name is (Z)-1-(2-acetylpyrrolidin-1-yl)-9-[(1R)-2-propylcyclopropyl]non-8-en-1-one;2-(4,7-dimethoxyquinolin-2-yl)-4-propan-2-yl-1,3-thiazole;ethyl formate.
| Compound Name | (Z)-1-(2-acetylpyrrolidin-1-yl)-9-[(1R)-2-propylcyclopropyl]non-8-en-1-one;2-(4,7-dimethoxyquinolin-2-yl)-4-propan-2-yl-1,3-thiazole;ethyl formate |
|---|---|
| PubChem CID | 143401223 |
| Molecular Formula | C41H59N3O6S |
| Molecular Weight | 722.01 g/mol |
| Exact Mass | 721.41 |
| IUPAC Name | (Z)-1-(2-acetylpyrrolidin-1-yl)-9-[(1R)-2-propylcyclopropyl]non-8-en-1-one;2-(4,7-dimethoxyquinolin-2-yl)-4-propan-2-yl-1,3-thiazole;ethyl formate |
| SMILES | CCCC1C[C@H]1/C=C\CCCCCCC(=O)N1CCCC1C(C)=O.CCOC=O.COc1ccc2c(OC)cc(-c3nc(C(C)C)cs3)nc2c1 |
| InChI | InChI=1S/C21H35NO2.C17H18N2O2S.C3H6O2/c1-3-11-18-16-19(18)12-8-6-4-5-7-9-14-21(24)22-15-10-13-20(22)17(2)23;1-10(2)15-9-22-17(19-15)14-8-16(21-4)12-6-5-11(20-3)7-13(12)18-14;1-2-5-3-4/h8,12,18-20H,3-7,9-11,13-16H2,1-2H3;5-10H,1-4H3;3H,2H2,1H3/b12-8-;;/t18?,19-,20?;;/m1../s1 |
| InChIKey | ZLAKQXBORNEQME-PEDOJQFYSA-N |
| XLogP | 9.58 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.01 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|