C17H25NO3 — CID 143675549
tert-butyl 4-[(3,3-dimethyl-1-oxobutan-2-yl)amino]benzoate (PubChem CID 143675549) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is tert-butyl 4-[(3,3-dimethyl-1-oxobutan-2-yl)amino]benzoate.
| Compound Name | tert-butyl 4-[(3,3-dimethyl-1-oxobutan-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 143675549 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | tert-butyl 4-[(3,3-dimethyl-1-oxobutan-2-yl)amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC(C=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-16(2,3)14(11-19)18-13-9-7-12(8-10-13)15(20)21-17(4,5)6/h7-11,14,18H,1-6H3 |
| InChIKey | FAYNLWBMKWZTQO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|