C33H39FN4O3 — CID 143677188
ethane;2-[3-fluoro-4-[[2-methyl-1-(4-methylphenyl)-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]-N'-methylbenzenecarboximidamide;formic acid (PubChem CID 143677188) has the molecular formula C33H39FN4O3 and a molecular weight of 558.70 g/mol. Its IUPAC name is ethane;2-[3-fluoro-4-[[2-methyl-1-(4-methylphenyl)-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]-N'-methylbenzenecarboximidamide;formic acid.
| Compound Name | ethane;2-[3-fluoro-4-[[2-methyl-1-(4-methylphenyl)-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]-N'-methylbenzenecarboximidamide;formic acid |
|---|---|
| PubChem CID | 143677188 |
| Molecular Formula | C33H39FN4O3 |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | ethane;2-[3-fluoro-4-[[2-methyl-1-(4-methylphenyl)-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]-N'-methylbenzenecarboximidamide;formic acid |
| SMILES | CC.CCCc1nc(C)n(-c2ccc(C)cc2)c(=O)c1Cc1ccc(-c2ccccc2/C(N)=N/C)cc1F.O=CO |
| InChI | InChI=1S/C30H31FN4O.C2H6.CH2O2/c1-5-8-28-26(30(36)35(20(3)34-28)23-15-11-19(2)12-16-23)17-22-14-13-21(18-27(22)31)24-9-6-7-10-25(24)29(32)33-4;1-2;2-1-3/h6-7,9-16,18H,5,8,17H2,1-4H3,(H2,32,33);1-2H3;1H,(H,2,3) |
| InChIKey | MQRWTBCRQSFQJZ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|