C30H28F2N4O3 — CID 143886716
N-[(Z)-C-[2-[4-[(4-butyl-2-methyl-6-oxo-1-phenylpyrimidin-5-yl)methyl]-3,5-difluorophenyl]phenyl]-N-hydroxycarbonimidoyl]formamide (PubChem CID 143886716) has the molecular formula C30H28F2N4O3 and a molecular weight of 530.58 g/mol. Its IUPAC name is N-[(Z)-C-[2-[4-[(4-butyl-2-methyl-6-oxo-1-phenylpyrimidin-5-yl)methyl]-3,5-difluorophenyl]phenyl]-N-hydroxycarbonimidoyl]formamide.
| Compound Name | N-[(Z)-C-[2-[4-[(4-butyl-2-methyl-6-oxo-1-phenylpyrimidin-5-yl)methyl]-3,5-difluorophenyl]phenyl]-N-hydroxycarbonimidoyl]formamide |
|---|---|
| PubChem CID | 143886716 |
| Molecular Formula | C30H28F2N4O3 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | N-[(Z)-C-[2-[4-[(4-butyl-2-methyl-6-oxo-1-phenylpyrimidin-5-yl)methyl]-3,5-difluorophenyl]phenyl]-N-hydroxycarbonimidoyl]formamide |
| SMILES | CCCCc1nc(C)n(-c2ccccc2)c(=O)c1Cc1c(F)cc(-c2ccccc2/C(=N/O)NC=O)cc1F |
| InChI | InChI=1S/C30H28F2N4O3/c1-3-4-14-28-25(30(38)36(19(2)34-28)21-10-6-5-7-11-21)17-24-26(31)15-20(16-27(24)32)22-12-8-9-13-23(22)29(35-39)33-18-37/h5-13,15-16,18,39H,3-4,14,17H2,1-2H3,(H,33,35,37) |
| InChIKey | YNMYQZPDEDLSHH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|