C32H34N4O4 — CID 143886698
N-[(Z)-C-[2-[4-[[4-butyl-1-[(4-hydroxyphenyl)methyl]-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]phenyl]-N-methoxycarbonimidoyl]formamide (PubChem CID 143886698) has the molecular formula C32H34N4O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is N-[(Z)-C-[2-[4-[[4-butyl-1-[(4-hydroxyphenyl)methyl]-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]phenyl]-N-methoxycarbonimidoyl]formamide.
| Compound Name | N-[(Z)-C-[2-[4-[[4-butyl-1-[(4-hydroxyphenyl)methyl]-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]phenyl]-N-methoxycarbonimidoyl]formamide |
|---|---|
| PubChem CID | 143886698 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | N-[(Z)-C-[2-[4-[[4-butyl-1-[(4-hydroxyphenyl)methyl]-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]phenyl]-N-methoxycarbonimidoyl]formamide |
| SMILES | CCCCc1nc(C)n(Cc2ccc(O)cc2)c(=O)c1Cc1ccc(-c2ccccc2/C(=N/OC)NC=O)cc1 |
| InChI | InChI=1S/C32H34N4O4/c1-4-5-10-30-29(32(39)36(22(2)34-30)20-24-13-17-26(38)18-14-24)19-23-11-15-25(16-12-23)27-8-6-7-9-28(27)31(33-21-37)35-40-3/h6-9,11-18,21,38H,4-5,10,19-20H2,1-3H3,(H,33,35,37) |
| InChIKey | SPFLKJICAGBHDM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|