C36H44N6O3 — CID 143677155
ethane;N-[(Z)-N-methoxy-C-[2-[4-[[2-(methylamino)-1-[2-methylimino-2-(2-methylphenyl)ethyl]-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]phenyl]carbonimidoyl]formamide (PubChem CID 143677155) has the molecular formula C36H44N6O3 and a molecular weight of 608.79 g/mol. Its IUPAC name is ethane;N-[(Z)-N-methoxy-C-[2-[4-[[2-(methylamino)-1-[2-methylimino-2-(2-methylphenyl)ethyl]-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]phenyl]carbonimidoyl]formamide.
| Compound Name | ethane;N-[(Z)-N-methoxy-C-[2-[4-[[2-(methylamino)-1-[2-methylimino-2-(2-methylphenyl)ethyl]-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]phenyl]carbonimidoyl]formamide |
|---|---|
| PubChem CID | 143677155 |
| Molecular Formula | C36H44N6O3 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.35 |
| IUPAC Name | ethane;N-[(Z)-N-methoxy-C-[2-[4-[[2-(methylamino)-1-[2-methylimino-2-(2-methylphenyl)ethyl]-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]phenyl]carbonimidoyl]formamide |
| SMILES | CC.CCCc1nc(NC)n(C/C(=N/C)c2ccccc2C)c(=O)c1Cc1ccc(-c2ccccc2/C(=N/OC)NC=O)cc1 |
| InChI | InChI=1S/C34H38N6O3.C2H6/c1-6-11-30-29(33(42)40(34(36-4)38-30)21-31(35-3)26-13-8-7-12-23(26)2)20-24-16-18-25(19-17-24)27-14-9-10-15-28(27)32(37-22-41)39-43-5;1-2/h7-10,12-19,22H,6,11,20-21H2,1-5H3,(H,36,38)(H,37,39,41);1-2H3/b35-31-; |
| InChIKey | IQVYINVQKSYTPF-FNFIKTCXSA-N |
| XLogP | 6.00 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|