C33H39N5O4 — CID 143677528
N-[(Z)-C-[6-[4-[[1-[3-(1-amino-1-hydroxyethyl)phenyl]-2-ethyl-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]cyclohexa-1,5-dien-1-yl]-N-methoxycarbonimidoyl]formamide (PubChem CID 143677528) has the molecular formula C33H39N5O4 and a molecular weight of 569.71 g/mol. Its IUPAC name is N-[(Z)-C-[6-[4-[[1-[3-(1-amino-1-hydroxyethyl)phenyl]-2-ethyl-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]cyclohexa-1,5-dien-1-yl]-N-methoxycarbonimidoyl]formamide.
| Compound Name | N-[(Z)-C-[6-[4-[[1-[3-(1-amino-1-hydroxyethyl)phenyl]-2-ethyl-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]cyclohexa-1,5-dien-1-yl]-N-methoxycarbonimidoyl]formamide |
|---|---|
| PubChem CID | 143677528 |
| Molecular Formula | C33H39N5O4 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | N-[(Z)-C-[6-[4-[[1-[3-(1-amino-1-hydroxyethyl)phenyl]-2-ethyl-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]cyclohexa-1,5-dien-1-yl]-N-methoxycarbonimidoyl]formamide |
| SMILES | CCCc1nc(CC)n(-c2cccc(C(C)(N)O)c2)c(=O)c1Cc1ccc(C2=CCCC=C2/C(=N/OC)NC=O)cc1 |
| InChI | InChI=1S/C33H39N5O4/c1-5-10-29-28(32(40)38(30(6-2)36-29)25-12-9-11-24(20-25)33(3,34)41)19-22-15-17-23(18-16-22)26-13-7-8-14-27(26)31(35-21-39)37-42-4/h9,11-18,20-21,41H,5-8,10,19,34H2,1-4H3,(H,35,37,39) |
| InChIKey | FYRNGZCLQAKSMA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|