C31H35NO10 — CID 143678971
16,17-dimethoxy-12-methyl-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaene;(2,5-dioxopyrrolidin-1-yl) 2-methoxyacetate (PubChem CID 143678971) has the molecular formula C31H35NO10 and a molecular weight of 581.62 g/mol. Its IUPAC name is 16,17-dimethoxy-12-methyl-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaene;(2,5-dioxopyrrolidin-1-yl) 2-methoxyacetate.
| Compound Name | 16,17-dimethoxy-12-methyl-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaene;(2,5-dioxopyrrolidin-1-yl) 2-methoxyacetate |
|---|---|
| PubChem CID | 143678971 |
| Molecular Formula | C31H35NO10 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | 16,17-dimethoxy-12-methyl-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaene;(2,5-dioxopyrrolidin-1-yl) 2-methoxyacetate |
| SMILES | C=C(C)C1Cc2c(ccc3c2OC2COc4cc(OC)c(OC)cc4C2C3C)O1.COCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C24H26O5.C7H9NO5/c1-12(2)18-9-16-17(28-18)7-6-14-13(3)23-15-8-20(25-4)21(26-5)10-19(15)27-11-22(23)29-24(14)16;1-12-4-7(11)13-8-5(9)2-3-6(8)10/h6-8,10,13,18,22-23H,1,9,11H2,2-5H3;2-4H2,1H3 |
| InChIKey | HSMYFOBAKAVIHN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|