C24H25FO6 — CID 89187185
13-(fluoromethyl)-16,17-dimethoxy-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-ol (PubChem CID 89187185) has the molecular formula C24H25FO6 and a molecular weight of 428.46 g/mol. Its IUPAC name is 13-(fluoromethyl)-16,17-dimethoxy-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-ol.
| Compound Name | 13-(fluoromethyl)-16,17-dimethoxy-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-ol |
|---|---|
| PubChem CID | 89187185 |
| Molecular Formula | C24H25FO6 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 13-(fluoromethyl)-16,17-dimethoxy-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-ol |
| SMILES | C=C(C)C1Cc2c(ccc3c2OC2COc4cc(OC)c(OC)cc4C2(CF)C3O)O1 |
| InChI | InChI=1S/C24H25FO6/c1-12(2)17-7-14-16(30-17)6-5-13-22(14)31-21-10-29-18-9-20(28-4)19(27-3)8-15(18)24(21,11-25)23(13)26/h5-6,8-9,17,21,23,26H,1,7,10-11H2,2-4H3 |
| InChIKey | IJJPIBBDSRJOTB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|