C27H28ClNO6 — CID 172937871
(Z,1S,6R,13R)-N-[(E)-3-chloroprop-2-enoxy]-16,17-dimethoxy-1-methyl-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-imine (PubChem CID 172937871) has the molecular formula C27H28ClNO6 and a molecular weight of 497.98 g/mol. Its IUPAC name is (Z,1S,6R,13R)-N-[(E)-3-chloroprop-2-enoxy]-16,17-dimethoxy-1-methyl-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-imine.
| Compound Name | (Z,1S,6R,13R)-N-[(E)-3-chloroprop-2-enoxy]-16,17-dimethoxy-1-methyl-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-imine |
|---|---|
| PubChem CID | 172937871 |
| Molecular Formula | C27H28ClNO6 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (Z,1S,6R,13R)-N-[(E)-3-chloroprop-2-enoxy]-16,17-dimethoxy-1-methyl-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-imine |
| SMILES | C=C(C)[C@H]1Cc2c(ccc3c2O[C@]2(C)COc4cc(OC)c(OC)cc4[C@@H]2/C3=N/OC/C=C/Cl)O1 |
| InChI | InChI=1S/C27H28ClNO6/c1-15(2)20-12-18-19(34-20)8-7-16-25(29-33-10-6-9-28)24-17-11-22(30-4)23(31-5)13-21(17)32-14-27(24,3)35-26(16)18/h6-9,11,13,20,24H,1,10,12,14H2,2-5H3/b9-6+,29-25+/t20-,24-,27-/m1/s1 |
| InChIKey | KKVWFYFXJOFRNA-RIYKWGHRSA-N |
| XLogP | 5.38 |
| TPSA | 67.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|