C32H30N2O7 — CID 571060
[5-(3-acetyl-7,8-dimethoxy-4,9b-dihydro-3aH-chromeno[3,4-c]pyrazol-1-yl)-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-yl] benzoate (PubChem CID 571060) has the molecular formula C32H30N2O7 and a molecular weight of 554.60 g/mol. Its IUPAC name is [5-(3-acetyl-7,8-dimethoxy-4,9b-dihydro-3aH-chromeno[3,4-c]pyrazol-1-yl)-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-yl] benzoate.
| Compound Name | [5-(3-acetyl-7,8-dimethoxy-4,9b-dihydro-3aH-chromeno[3,4-c]pyrazol-1-yl)-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-yl] benzoate |
|---|---|
| PubChem CID | 571060 |
| Molecular Formula | C32H30N2O7 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | [5-(3-acetyl-7,8-dimethoxy-4,9b-dihydro-3aH-chromeno[3,4-c]pyrazol-1-yl)-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-yl] benzoate |
| SMILES | C=C(C)C1Cc2c(ccc(C3=NN(C(C)=O)C4COc5cc(OC)c(OC)cc5C34)c2OC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C32H30N2O7/c1-17(2)25-14-22-24(40-25)12-11-20(31(22)41-32(36)19-9-7-6-8-10-19)30-29-21-13-27(37-4)28(38-5)15-26(21)39-16-23(29)34(33-30)18(3)35/h6-13,15,23,25,29H,1,14,16H2,2-5H3 |
| InChIKey | BDBCJEXISGKXDH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 95.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|