C24H25NO6S2 — CID 137084443
5-[7,8-dimethoxy-9b-sulfanyl-3a-(sulfanylmethyl)-4H-chromeno[4,3-d][1,2]oxazol-1-yl]-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-ol (PubChem CID 137084443) has the molecular formula C24H25NO6S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is 5-[7,8-dimethoxy-9b-sulfanyl-3a-(sulfanylmethyl)-4H-chromeno[4,3-d][1,2]oxazol-1-yl]-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-ol.
| Compound Name | 5-[7,8-dimethoxy-9b-sulfanyl-3a-(sulfanylmethyl)-4H-chromeno[4,3-d][1,2]oxazol-1-yl]-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 137084443 |
| Molecular Formula | C24H25NO6S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 5-[7,8-dimethoxy-9b-sulfanyl-3a-(sulfanylmethyl)-4H-chromeno[4,3-d][1,2]oxazol-1-yl]-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-ol |
| SMILES | C=C(C)C1Cc2c(ccc(C3=NOC4(CS)COc5cc(OC)c(OC)cc5C34S)c2O)O1 |
| InChI | InChI=1S/C24H25NO6S2/c1-12(2)17-7-14-16(30-17)6-5-13(21(14)26)22-24(33)15-8-19(27-3)20(28-4)9-18(15)29-10-23(24,11-32)31-25-22/h5-6,8-9,17,26,32-33H,1,7,10-11H2,2-4H3 |
| InChIKey | NBJVVPNIINLKON-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|