C27H30N2O5 — CID 172984129
(2R)-5-[(E)-C-(5,6-dimethoxy-1a,2-dihydro-1H-cyclopropa[c]chromen-7b-yl)-N-(propan-2-ylideneamino)carbonimidoyl]-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-ol (PubChem CID 172984129) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is (2R)-5-[(E)-C-(5,6-dimethoxy-1a,2-dihydro-1H-cyclopropa[c]chromen-7b-yl)-N-(propan-2-ylideneamino)carbonimidoyl]-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-ol.
| Compound Name | (2R)-5-[(E)-C-(5,6-dimethoxy-1a,2-dihydro-1H-cyclopropa[c]chromen-7b-yl)-N-(propan-2-ylideneamino)carbonimidoyl]-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 172984129 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (2R)-5-[(E)-C-(5,6-dimethoxy-1a,2-dihydro-1H-cyclopropa[c]chromen-7b-yl)-N-(propan-2-ylideneamino)carbonimidoyl]-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-ol |
| SMILES | C=C(C)[C@H]1Cc2c(ccc(/C(=N/N=C(C)C)C34CC3COc3cc(OC)c(OC)cc34)c2O)O1 |
| InChI | InChI=1S/C27H30N2O5/c1-14(2)21-9-18-20(34-21)8-7-17(25(18)30)26(29-28-15(3)4)27-12-16(27)13-33-22-11-24(32-6)23(31-5)10-19(22)27/h7-8,10-11,16,21,30H,1,9,12-13H2,2-6H3/b29-26-/t16?,21-,27?/m1/s1 |
| InChIKey | QAIBOOSSSBWSTR-AEIWOCEASA-N |
| XLogP | 4.82 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|