About (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal
(3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal (PubChem CID 143680466) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal.
Molecular Properties
| Compound Name | (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal |
| PubChem CID | 143680466 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal |
| SMILES | C=N/C(=C\C=C/CC=O)OC |
| InChI | InChI=1S/C8H11NO2/c1-9-8(11-2)6-4-3-5-7-10/h3-4,6-7H,1,5H2,2H3/b4-3-,8-6+ |
| InChIKey | JCMDRTRUSNODNP-OONGGIDMSA-N |
| XLogP | 1.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal?
The IUPAC name of (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal (CID 143680466) is (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal.
What is the SMILES notation for (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal?
The canonical SMILES for (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal is C=N/C(=C\C=C/CC=O)OC.
What is the InChIKey of (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal?
The InChIKey is JCMDRTRUSNODNP-OONGGIDMSA-N. The full InChI is InChI=1S/C8H11NO2/c1-9-8(11-2)6-4-3-5-7-10/h3-4,6-7H,1,5H2,2H3/b4-3-,8-6+.
What are the key properties of (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal?
(3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal has a molecular weight of 153.18 g/mol, XLogP of 1.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-6-methoxy-6-(methylideneamino)hexa-3,5-dienal is sourced from PubChem (CID 143680466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).