C18H27NO — CID 143682179
(1S)-4-[(Z)-6-oxoundec-8-enyl]cyclohex-2-ene-1-carbonitrile (PubChem CID 143682179) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (1S)-4-[(Z)-6-oxoundec-8-enyl]cyclohex-2-ene-1-carbonitrile.
| Compound Name | (1S)-4-[(Z)-6-oxoundec-8-enyl]cyclohex-2-ene-1-carbonitrile |
|---|---|
| PubChem CID | 143682179 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (1S)-4-[(Z)-6-oxoundec-8-enyl]cyclohex-2-ene-1-carbonitrile |
| SMILES | CC/C=C\CC(=O)CCCCCC1C=C[C@@H](C#N)CC1 |
| InChI | InChI=1S/C18H27NO/c1-2-3-5-9-18(20)10-7-4-6-8-16-11-13-17(15-19)14-12-16/h3,5,11,13,16-17H,2,4,6-10,12,14H2,1H3/b5-3-/t16?,17-/m1/s1 |
| InChIKey | MLWSSVAHCMEJLE-PMNAWAMOSA-N |
| XLogP | 4.97 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|