C30H52O — CID 160586685
(Z)-3-methyl-15-[3-[(3Z,6Z)-nona-3,6-dienyl]cyclopentyl]pentadec-12-en-6-one (PubChem CID 160586685) has the molecular formula C30H52O and a molecular weight of 428.75 g/mol. Its IUPAC name is (Z)-3-methyl-15-[3-[(3Z,6Z)-nona-3,6-dienyl]cyclopentyl]pentadec-12-en-6-one.
| Compound Name | (Z)-3-methyl-15-[3-[(3Z,6Z)-nona-3,6-dienyl]cyclopentyl]pentadec-12-en-6-one |
|---|---|
| PubChem CID | 160586685 |
| Molecular Formula | C30H52O |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.40 |
| IUPAC Name | (Z)-3-methyl-15-[3-[(3Z,6Z)-nona-3,6-dienyl]cyclopentyl]pentadec-12-en-6-one |
| SMILES | CC/C=C\C/C=C\CCC1CCC(CC/C=C\CCCCCC(=O)CCC(C)CC)C1 |
| InChI | InChI=1S/C30H52O/c1-4-6-7-8-10-13-16-19-28-23-24-29(26-28)20-17-14-11-9-12-15-18-21-30(31)25-22-27(3)5-2/h6-7,10-11,13-14,27-29H,4-5,8-9,12,15-26H2,1-3H3/b7-6-,13-10-,14-11- |
| InChIKey | ZXRYCVKCASGPJL-GNZZTDHISA-N |
| XLogP | 9.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|