C41H33N3 — CID 143685303
(2E,4E)-5-[4-[4-(dinaphthalen-2-ylamino)phenyl]-N-methylanilino]-2-ethenylhexa-2,4-dienenitrile (PubChem CID 143685303) has the molecular formula C41H33N3 and a molecular weight of 567.74 g/mol. Its IUPAC name is (2E,4E)-5-[4-[4-(dinaphthalen-2-ylamino)phenyl]-N-methylanilino]-2-ethenylhexa-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-[4-[4-(dinaphthalen-2-ylamino)phenyl]-N-methylanilino]-2-ethenylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 143685303 |
| Molecular Formula | C41H33N3 |
| Molecular Weight | 567.74 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | (2E,4E)-5-[4-[4-(dinaphthalen-2-ylamino)phenyl]-N-methylanilino]-2-ethenylhexa-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C\C=C(/C)N(C)c1ccc(-c2ccc(N(c3ccc4ccccc4c3)c3ccc4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/C41H33N3/c1-4-31(29-42)14-13-30(2)43(3)38-21-15-34(16-22-38)35-17-23-39(24-18-35)44(40-25-19-32-9-5-7-11-36(32)27-40)41-26-20-33-10-6-8-12-37(33)28-41/h4-28H,1H2,2-3H3/b30-13+,31-14+ |
| InChIKey | GUZNZUCSDGVRLW-HNZHSOEWSA-N |
| XLogP | 11.11 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.74 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|