C46H36O10S2 — CID 143687006
1,4-diphenacyl-2,5-bis[4-(thiophene-2-carbonyloxy)phenyl]cyclohexane-1,4-dicarboxylic acid (PubChem CID 143687006) has the molecular formula C46H36O10S2 and a molecular weight of 812.92 g/mol. Its IUPAC name is 1,4-diphenacyl-2,5-bis[4-(thiophene-2-carbonyloxy)phenyl]cyclohexane-1,4-dicarboxylic acid.
| Compound Name | 1,4-diphenacyl-2,5-bis[4-(thiophene-2-carbonyloxy)phenyl]cyclohexane-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 143687006 |
| Molecular Formula | C46H36O10S2 |
| Molecular Weight | 812.92 g/mol |
| Exact Mass | 812.17 |
| IUPAC Name | 1,4-diphenacyl-2,5-bis[4-(thiophene-2-carbonyloxy)phenyl]cyclohexane-1,4-dicarboxylic acid |
| SMILES | O=C(CC1(C(=O)O)CC(c2ccc(OC(=O)c3cccs3)cc2)C(CC(=O)c2ccccc2)(C(=O)O)CC1c1ccc(OC(=O)c2cccs2)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H36O10S2/c47-37(31-9-3-1-4-10-31)27-45(43(51)52)25-36(30-17-21-34(22-18-30)56-42(50)40-14-8-24-58-40)46(44(53)54,28-38(48)32-11-5-2-6-12-32)26-35(45)29-15-19-33(20-16-29)55-41(49)39-13-7-23-57-39/h1-24,35-36H,25-28H2,(H,51,52)(H,53,54) |
| InChIKey | INIJLZCAHLXVHS-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.92 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|