C45H42N4O10S2 — CID 145484532
4-aminobenzaldehyde;1-[(4-aminobenzoyl)amino]-3-(methylamino)-2,4-bis[4-(thiophene-2-carbonyloxy)phenyl]cyclobutane-1,3-dicarboxylic acid;ethane (PubChem CID 145484532) has the molecular formula C45H42N4O10S2 and a molecular weight of 862.98 g/mol. Its IUPAC name is 4-aminobenzaldehyde;1-[(4-aminobenzoyl)amino]-3-(methylamino)-2,4-bis[4-(thiophene-2-carbonyloxy)phenyl]cyclobutane-1,3-dicarboxylic acid;ethane.
| Compound Name | 4-aminobenzaldehyde;1-[(4-aminobenzoyl)amino]-3-(methylamino)-2,4-bis[4-(thiophene-2-carbonyloxy)phenyl]cyclobutane-1,3-dicarboxylic acid;ethane |
|---|---|
| PubChem CID | 145484532 |
| Molecular Formula | C45H42N4O10S2 |
| Molecular Weight | 862.98 g/mol |
| Exact Mass | 862.23 |
| IUPAC Name | 4-aminobenzaldehyde;1-[(4-aminobenzoyl)amino]-3-(methylamino)-2,4-bis[4-(thiophene-2-carbonyloxy)phenyl]cyclobutane-1,3-dicarboxylic acid;ethane |
| SMILES | CC.CNC1(C(=O)O)C(c2ccc(OC(=O)c3cccs3)cc2)C(NC(=O)c2ccc(N)cc2)(C(=O)O)C1c1ccc(OC(=O)c2cccs2)cc1.Nc1ccc(C=O)cc1 |
| InChI | InChI=1S/C36H29N3O9S2.C7H7NO.C2H6/c1-38-35(33(43)44)28(20-8-14-24(15-9-20)47-31(41)26-4-2-18-49-26)36(34(45)46,39-30(40)22-6-12-23(37)13-7-22)29(35)21-10-16-25(17-11-21)48-32(42)27-5-3-19-50-27;8-7-3-1-6(5-9)2-4-7;1-2/h2-19,28-29,38H,37H2,1H3,(H,39,40)(H,43,44)(H,45,46);1-5H,8H2;1-2H3 |
| InChIKey | BSRSSWPRUFMTHH-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 237.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.98 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|