C29H37N3O5 — CID 143687901
tert-butyl 4-[[1-(2-ethoxyethyl)-2-oxo-7-phenoxyquinolin-3-yl]methyl]piperazine-1-carboxylate (PubChem CID 143687901) has the molecular formula C29H37N3O5 and a molecular weight of 507.63 g/mol. Its IUPAC name is tert-butyl 4-[[1-(2-ethoxyethyl)-2-oxo-7-phenoxyquinolin-3-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(2-ethoxyethyl)-2-oxo-7-phenoxyquinolin-3-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143687901 |
| Molecular Formula | C29H37N3O5 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | tert-butyl 4-[[1-(2-ethoxyethyl)-2-oxo-7-phenoxyquinolin-3-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCOCCn1c(=O)c(CN2CCN(C(=O)OC(C)(C)C)CC2)cc2ccc(Oc3ccccc3)cc21 |
| InChI | InChI=1S/C29H37N3O5/c1-5-35-18-17-32-26-20-25(36-24-9-7-6-8-10-24)12-11-22(26)19-23(27(32)33)21-30-13-15-31(16-14-30)28(34)37-29(2,3)4/h6-12,19-20H,5,13-18,21H2,1-4H3 |
| InChIKey | SYKVPYSSYIEHKX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|