C20H22N2O4 — CID 143687924
1-(2-aminoethyl)-3-(dimethoxymethyl)-7-phenoxyquinolin-2-one (PubChem CID 143687924) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-(dimethoxymethyl)-7-phenoxyquinolin-2-one.
| Compound Name | 1-(2-aminoethyl)-3-(dimethoxymethyl)-7-phenoxyquinolin-2-one |
|---|---|
| PubChem CID | 143687924 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-(2-aminoethyl)-3-(dimethoxymethyl)-7-phenoxyquinolin-2-one |
| SMILES | COC(OC)c1cc2ccc(Oc3ccccc3)cc2n(CCN)c1=O |
| InChI | InChI=1S/C20H22N2O4/c1-24-20(25-2)17-12-14-8-9-16(26-15-6-4-3-5-7-15)13-18(14)22(11-10-21)19(17)23/h3-9,12-13,20H,10-11,21H2,1-2H3 |
| InChIKey | XFZKEFLJEDSXLM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|