C25H41N3O5 — CID 143689006
2-[[1-[4-(tert-butylamino)-2-cyclohexyl-4-oxobutanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpent-4-enoic acid (PubChem CID 143689006) has the molecular formula C25H41N3O5 and a molecular weight of 463.62 g/mol. Its IUPAC name is 2-[[1-[4-(tert-butylamino)-2-cyclohexyl-4-oxobutanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpent-4-enoic acid.
| Compound Name | 2-[[1-[4-(tert-butylamino)-2-cyclohexyl-4-oxobutanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpent-4-enoic acid |
|---|---|
| PubChem CID | 143689006 |
| Molecular Formula | C25H41N3O5 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.30 |
| IUPAC Name | 2-[[1-[4-(tert-butylamino)-2-cyclohexyl-4-oxobutanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpent-4-enoic acid |
| SMILES | C=CC(C)C(NC(=O)C1CCCN1C(=O)C(CC(=O)NC(C)(C)C)C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C25H41N3O5/c1-6-16(2)21(24(32)33)26-22(30)19-13-10-14-28(19)23(31)18(17-11-8-7-9-12-17)15-20(29)27-25(3,4)5/h6,16-19,21H,1,7-15H2,2-5H3,(H,26,30)(H,27,29)(H,32,33) |
| InChIKey | VXRQBNXJXGIPQY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|