C14H21FO3S — CID 143692255
[4-(2-fluorophenyl)-2,4-dimethylpentan-2-yl] methanesulfonate (PubChem CID 143692255) has the molecular formula C14H21FO3S and a molecular weight of 288.38 g/mol. Its IUPAC name is [4-(2-fluorophenyl)-2,4-dimethylpentan-2-yl] methanesulfonate.
| Compound Name | [4-(2-fluorophenyl)-2,4-dimethylpentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 143692255 |
| Molecular Formula | C14H21FO3S |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | [4-(2-fluorophenyl)-2,4-dimethylpentan-2-yl] methanesulfonate |
| SMILES | CC(C)(CC(C)(C)c1ccccc1F)OS(C)(=O)=O |
| InChI | InChI=1S/C14H21FO3S/c1-13(2,11-8-6-7-9-12(11)15)10-14(3,4)18-19(5,16)17/h6-9H,10H2,1-5H3 |
| InChIKey | GFWZXKNSNUARNB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|