C29H40FNO — CID 143695973
1-fluoro-4-methylbenzene;1-phenylpropan-2-one;(3Z,5Z)-N,N,5-triethylhepta-1,3,5-trien-2-amine (PubChem CID 143695973) has the molecular formula C29H40FNO and a molecular weight of 437.64 g/mol. Its IUPAC name is 1-fluoro-4-methylbenzene;1-phenylpropan-2-one;(3Z,5Z)-N,N,5-triethylhepta-1,3,5-trien-2-amine.
| Compound Name | 1-fluoro-4-methylbenzene;1-phenylpropan-2-one;(3Z,5Z)-N,N,5-triethylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143695973 |
| Molecular Formula | C29H40FNO |
| Molecular Weight | 437.64 g/mol |
| Exact Mass | 437.31 |
| IUPAC Name | 1-fluoro-4-methylbenzene;1-phenylpropan-2-one;(3Z,5Z)-N,N,5-triethylhepta-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(=C/C)CC)N(CC)CC.CC(=O)Cc1ccccc1.Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H23N.C9H10O.C7H7F/c1-6-13(7-2)11-10-12(5)14(8-3)9-4;1-8(10)7-9-5-3-2-4-6-9;1-6-2-4-7(8)5-3-6/h6,10-11H,5,7-9H2,1-4H3;2-6H,7H2,1H3;2-5H,1H3/b11-10-,13-6-;; |
| InChIKey | JNWOEZXVMAIVAP-WJWCNEBZSA-N |
| XLogP | 7.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.64 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|