C21H32N2O3 — CID 143697457
tert-butyl 2-(4-amino-3-methylbenzoyl)-2-butylpyrrolidine-1-carboxylate (PubChem CID 143697457) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is tert-butyl 2-(4-amino-3-methylbenzoyl)-2-butylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-amino-3-methylbenzoyl)-2-butylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143697457 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | tert-butyl 2-(4-amino-3-methylbenzoyl)-2-butylpyrrolidine-1-carboxylate |
| SMILES | CCCCC1(C(=O)c2ccc(N)c(C)c2)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32N2O3/c1-6-7-11-21(18(24)16-9-10-17(22)15(2)14-16)12-8-13-23(21)19(25)26-20(3,4)5/h9-10,14H,6-8,11-13,22H2,1-5H3 |
| InChIKey | KSZDREBHGAKREK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|