C21H30ClNO3 — CID 154472630
tert-butyl 2-butyl-2-(4-chloro-3-methylbenzoyl)pyrrolidine-1-carboxylate (PubChem CID 154472630) has the molecular formula C21H30ClNO3 and a molecular weight of 379.93 g/mol. Its IUPAC name is tert-butyl 2-butyl-2-(4-chloro-3-methylbenzoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-butyl-2-(4-chloro-3-methylbenzoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154472630 |
| Molecular Formula | C21H30ClNO3 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | tert-butyl 2-butyl-2-(4-chloro-3-methylbenzoyl)pyrrolidine-1-carboxylate |
| SMILES | CCCCC1(C(=O)c2ccc(Cl)c(C)c2)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30ClNO3/c1-6-7-11-21(18(24)16-9-10-17(22)15(2)14-16)12-8-13-23(21)19(25)26-20(3,4)5/h9-10,14H,6-8,11-13H2,1-5H3 |
| InChIKey | SSMJWSWXHXLYDI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |