C23H28N2 — CID 143699020
4-[4-[1-(3-amino-4-methylphenyl)propan-2-yl]cyclohexyl]benzonitrile (PubChem CID 143699020) has the molecular formula C23H28N2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 4-[4-[1-(3-amino-4-methylphenyl)propan-2-yl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[1-(3-amino-4-methylphenyl)propan-2-yl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 143699020 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 4-[4-[1-(3-amino-4-methylphenyl)propan-2-yl]cyclohexyl]benzonitrile |
| SMILES | Cc1ccc(CC(C)C2CCC(c3ccc(C#N)cc3)CC2)cc1N |
| InChI | InChI=1S/C23H28N2/c1-16-3-4-19(14-23(16)25)13-17(2)20-9-11-22(12-10-20)21-7-5-18(15-24)6-8-21/h3-8,14,17,20,22H,9-13,25H2,1-2H3 |
| InChIKey | SPTSWYRZPRELGR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|