C10H4F14 — CID 143700246
4-(difluoromethylidene)-1,1,2-trifluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclopentane (PubChem CID 143700246) has the molecular formula C10H4F14 and a molecular weight of 390.11 g/mol. Its IUPAC name is 4-(difluoromethylidene)-1,1,2-trifluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclopentane.
| Compound Name | 4-(difluoromethylidene)-1,1,2-trifluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclopentane |
|---|---|
| PubChem CID | 143700246 |
| Molecular Formula | C10H4F14 |
| Molecular Weight | 390.11 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 4-(difluoromethylidene)-1,1,2-trifluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclopentane |
| SMILES | FC(F)=C1CC(F)(F)C(F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C10H4F14/c11-4(12)3-1-5(13,6(14,15)2-3)7(16,17)8(18,19)9(20,21)10(22,23)24/h1-2H2 |
| InChIKey | XIOHYAWLEWZWJW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.11 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|