C15H5F25 — CID 154135019
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,10,11,11,13-henicosafluoro-9-(fluoromethylidene)-10-(trifluoromethyl)tridecane (PubChem CID 154135019) has the molecular formula C15H5F25 and a molecular weight of 660.15 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,10,11,11,13-henicosafluoro-9-(fluoromethylidene)-10-(trifluoromethyl)tridecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,10,11,11,13-henicosafluoro-9-(fluoromethylidene)-10-(trifluoromethyl)tridecane |
|---|---|
| PubChem CID | 154135019 |
| Molecular Formula | C15H5F25 |
| Molecular Weight | 660.15 g/mol |
| Exact Mass | 660.00 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,10,11,11,13-henicosafluoro-9-(fluoromethylidene)-10-(trifluoromethyl)tridecane |
| SMILES | FC=C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)CCF |
| InChI | InChI=1S/C15H5F25/c16-2-1-5(18,19)6(20,14(35,36)37)4(3-17)7(21,22)8(23,24)9(25,26)10(27,28)11(29,30)12(31,32)13(33,34)15(38,39)40/h3H,1-2H2 |
| InChIKey | JFNXUVFDGLHQDU-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.15 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|