C9H5F13 — CID 150641531
1,1,2,3,4,4,5,6,6,8-decafluoro-5-(trifluoromethyl)oct-1-ene (PubChem CID 150641531) has the molecular formula C9H5F13 and a molecular weight of 360.11 g/mol. Its IUPAC name is 1,1,2,3,4,4,5,6,6,8-decafluoro-5-(trifluoromethyl)oct-1-ene.
| Compound Name | 1,1,2,3,4,4,5,6,6,8-decafluoro-5-(trifluoromethyl)oct-1-ene |
|---|---|
| PubChem CID | 150641531 |
| Molecular Formula | C9H5F13 |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 1,1,2,3,4,4,5,6,6,8-decafluoro-5-(trifluoromethyl)oct-1-ene |
| SMILES | FCCC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)C(F)=C(F)F |
| InChI | InChI=1S/C9H5F13/c10-2-1-6(15,16)8(19,9(20,21)22)7(17,18)4(12)3(11)5(13)14/h4H,1-2H2 |
| InChIKey | IZZZHHIDDJPVFO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |