About ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne
ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne (PubChem CID 143703246) has the molecular formula C14H26OS
and a molecular weight of 242.43 g/mol. Its IUPAC name is ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne.
Molecular Properties
| Compound Name | ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne |
| PubChem CID | 143703246 |
| Molecular Formula | C14H26OS |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne |
| SMILES | C#CC.C#CC(O)C(CC)SC(C)C.CC |
| InChI | InChI=1S/C9H16OS.C3H4.C2H6/c1-5-8(10)9(6-2)11-7(3)4;1-3-2;1-2/h1,7-10H,6H2,2-4H3;1H,2H3;1-2H3 |
| InChIKey | WBBJXQAQIKLEEY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne?
The IUPAC name of ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne (CID 143703246) is ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne.
What is the SMILES notation for ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne?
The canonical SMILES for ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne is C#CC.C#CC(O)C(CC)SC(C)C.CC.
What is the InChIKey of ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne?
The InChIKey is WBBJXQAQIKLEEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS.C3H4.C2H6/c1-5-8(10)9(6-2)11-7(3)4;1-3-2;1-2/h1,7-10H,6H2,2-4H3;1H,2H3;1-2H3.
What are the key properties of ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne?
ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne has a molecular weight of 242.43 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-propan-2-ylsulfanylhex-1-yn-3-ol;prop-1-yne is sourced from PubChem (CID 143703246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).