C25H45NS — CID 143703341
but-1-ene;1-(4-hept-6-enylsulfanyl-2-methylcyclohexa-1,5-dien-1-yl)propan-2-amine;2-methylprop-1-ene (PubChem CID 143703341) has the molecular formula C25H45NS and a molecular weight of 391.71 g/mol. Its IUPAC name is but-1-ene;1-(4-hept-6-enylsulfanyl-2-methylcyclohexa-1,5-dien-1-yl)propan-2-amine;2-methylprop-1-ene.
| Compound Name | but-1-ene;1-(4-hept-6-enylsulfanyl-2-methylcyclohexa-1,5-dien-1-yl)propan-2-amine;2-methylprop-1-ene |
|---|---|
| PubChem CID | 143703341 |
| Molecular Formula | C25H45NS |
| Molecular Weight | 391.71 g/mol |
| Exact Mass | 391.33 |
| IUPAC Name | but-1-ene;1-(4-hept-6-enylsulfanyl-2-methylcyclohexa-1,5-dien-1-yl)propan-2-amine;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=CCC.C=CCCCCCSC1C=CC(CC(C)N)=C(C)C1 |
| InChI | InChI=1S/C17H29NS.2C4H8/c1-4-5-6-7-8-11-19-17-10-9-16(13-15(3)18)14(2)12-17;1-4(2)3;1-3-4-2/h4,9-10,15,17H,1,5-8,11-13,18H2,2-3H3;1H2,2-3H3;3H,1,4H2,2H3 |
| InChIKey | CHYYUBITQBNLJZ-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.71 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|