C7H11F2NO6 — CID 143704751
4,4-difluoro-1,3,3,5,5-pentahydroxycyclohexane-1-carboxamide (PubChem CID 143704751) has the molecular formula C7H11F2NO6 and a molecular weight of 243.16 g/mol. Its IUPAC name is 4,4-difluoro-1,3,3,5,5-pentahydroxycyclohexane-1-carboxamide.
| Compound Name | 4,4-difluoro-1,3,3,5,5-pentahydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 143704751 |
| Molecular Formula | C7H11F2NO6 |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 4,4-difluoro-1,3,3,5,5-pentahydroxycyclohexane-1-carboxamide |
| SMILES | NC(=O)C1(O)CC(O)(O)C(F)(F)C(O)(O)C1 |
| InChI | InChI=1S/C7H11F2NO6/c8-7(9)5(13,14)1-4(12,3(10)11)2-6(7,15)16/h12-16H,1-2H2,(H2,10,11) |
| InChIKey | INZADOBEXIPMDJ-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|