C8H19NO4 — CID 143704777
6-amino-5-methylheptane-3,3,4,4-tetrol (PubChem CID 143704777) has the molecular formula C8H19NO4 and a molecular weight of 193.24 g/mol. Its IUPAC name is 6-amino-5-methylheptane-3,3,4,4-tetrol.
| Compound Name | 6-amino-5-methylheptane-3,3,4,4-tetrol |
|---|---|
| PubChem CID | 143704777 |
| Molecular Formula | C8H19NO4 |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 6-amino-5-methylheptane-3,3,4,4-tetrol |
| SMILES | CCC(O)(O)C(O)(O)C(C)C(C)N |
| InChI | InChI=1S/C8H19NO4/c1-4-7(10,11)8(12,13)5(2)6(3)9/h5-6,10-13H,4,9H2,1-3H3 |
| InChIKey | KSUFWSVWDXOZRY-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|