C23H23ClN2O — CID 143706175
2-[4-(3-chlorophenyl)cyclohexyl]-6-(2-methylphenyl)pyridazin-3-one (PubChem CID 143706175) has the molecular formula C23H23ClN2O and a molecular weight of 378.90 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)cyclohexyl]-6-(2-methylphenyl)pyridazin-3-one.
| Compound Name | 2-[4-(3-chlorophenyl)cyclohexyl]-6-(2-methylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 143706175 |
| Molecular Formula | C23H23ClN2O |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-[4-(3-chlorophenyl)cyclohexyl]-6-(2-methylphenyl)pyridazin-3-one |
| SMILES | Cc1ccccc1-c1ccc(=O)n(C2CCC(c3cccc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C23H23ClN2O/c1-16-5-2-3-8-21(16)22-13-14-23(27)26(25-22)20-11-9-17(10-12-20)18-6-4-7-19(24)15-18/h2-8,13-15,17,20H,9-12H2,1H3 |
| InChIKey | OWIPEHGLKNHRNP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |