C35H50N4 — CID 143706609
N-[2-[1-(heptan-4-ylamino)ethenyl]-6-(4-methylphenyl)-3-pyridinyl]-N'-[(4-methylphenyl)methyl]ethanimidamide;2-methylpropane (PubChem CID 143706609) has the molecular formula C35H50N4 and a molecular weight of 526.81 g/mol. Its IUPAC name is N-[2-[1-(heptan-4-ylamino)ethenyl]-6-(4-methylphenyl)-3-pyridinyl]-N'-[(4-methylphenyl)methyl]ethanimidamide;2-methylpropane.
| Compound Name | N-[2-[1-(heptan-4-ylamino)ethenyl]-6-(4-methylphenyl)-3-pyridinyl]-N'-[(4-methylphenyl)methyl]ethanimidamide;2-methylpropane |
|---|---|
| PubChem CID | 143706609 |
| Molecular Formula | C35H50N4 |
| Molecular Weight | 526.81 g/mol |
| Exact Mass | 526.40 |
| IUPAC Name | N-[2-[1-(heptan-4-ylamino)ethenyl]-6-(4-methylphenyl)-3-pyridinyl]-N'-[(4-methylphenyl)methyl]ethanimidamide;2-methylpropane |
| SMILES | C=C(NC(CCC)CCC)c1nc(-c2ccc(C)cc2)ccc1N/C(C)=N/Cc1ccc(C)cc1.CC(C)C |
| InChI | InChI=1S/C31H40N4.C4H10/c1-7-9-28(10-8-2)33-24(5)31-30(20-19-29(35-31)27-17-13-23(4)14-18-27)34-25(6)32-21-26-15-11-22(3)12-16-26;1-4(2)3/h11-20,28,33H,5,7-10,21H2,1-4,6H3,(H,32,34);4H,1-3H3 |
| InChIKey | IWBRZGOMWVERRP-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.81 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|