C19H17F3N6OS — CID 143706948
ethanimidoyl 3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridine-7-carboximidothioate (PubChem CID 143706948) has the molecular formula C19H17F3N6OS and a molecular weight of 434.45 g/mol. Its IUPAC name is ethanimidoyl 3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridine-7-carboximidothioate.
| Compound Name | ethanimidoyl 3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridine-7-carboximidothioate |
|---|---|
| PubChem CID | 143706948 |
| Molecular Formula | C19H17F3N6OS |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | ethanimidoyl 3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridine-7-carboximidothioate |
| SMILES | [H]/N=C(\S/C(C)=N/[H])c1ccn2c(-c3cccc(NC(=O)NCC(F)(F)F)c3)cnc2c1 |
| InChI | InChI=1S/C19H17F3N6OS/c1-11(23)30-17(24)13-5-6-28-15(9-25-16(28)8-13)12-3-2-4-14(7-12)27-18(29)26-10-19(20,21)22/h2-9,23-24H,10H2,1H3,(H2,26,27,29)/b23-11+,24-17- |
| InChIKey | UCCDFSZTYOMWSH-BPNHVHFMSA-N |
| XLogP | 4.74 |
| TPSA | 106.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|