C17H14F3N7O — CID 143707202
1-[3-[7-(N-iminocarbamimidoyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 143707202) has the molecular formula C17H14F3N7O and a molecular weight of 389.34 g/mol. Its IUPAC name is 1-[3-[7-(N-iminocarbamimidoyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-(N-iminocarbamimidoyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 143707202 |
| Molecular Formula | C17H14F3N7O |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 1-[3-[7-(N-iminocarbamimidoyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | [H]/N=C(\N=N\[H])c1ccn2c(-c3cccc(NC(=O)NCC(F)(F)F)c3)cnc2c1 |
| InChI | InChI=1S/C17H14F3N7O/c18-17(19,20)9-24-16(28)25-12-3-1-2-10(6-12)13-8-23-14-7-11(15(21)26-22)4-5-27(13)14/h1-8,21-22H,9H2,(H2,24,25,28)/b21-15-,26-22+ |
| InChIKey | CPIDMCZTMKRBMY-ZRTJXFFSSA-N |
| XLogP | 4.04 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|