C25H29F3N6O — CID 143706985
1-[3-[7-[N'-[(E)-5-methylhept-3-en-4-yl]carbamimidoyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 143706985) has the molecular formula C25H29F3N6O and a molecular weight of 486.54 g/mol. Its IUPAC name is 1-[3-[7-[N'-[(E)-5-methylhept-3-en-4-yl]carbamimidoyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-[N'-[(E)-5-methylhept-3-en-4-yl]carbamimidoyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 143706985 |
| Molecular Formula | C25H29F3N6O |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 1-[3-[7-[N'-[(E)-5-methylhept-3-en-4-yl]carbamimidoyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC/C=C(/N=C(\N)c1ccn2c(-c3cccc(NC(=O)NCC(F)(F)F)c3)cnc2c1)C(C)CC |
| InChI | InChI=1S/C25H29F3N6O/c1-4-7-20(16(3)5-2)33-23(29)18-10-11-34-21(14-30-22(34)13-18)17-8-6-9-19(12-17)32-24(35)31-15-25(26,27)28/h6-14,16H,4-5,15H2,1-3H3,(H2,29,33)(H2,31,32,35)/b20-7+ |
| InChIKey | DALKQLOTRDXDBS-IFRROFPPSA-N |
| XLogP | 5.73 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|