C21H23F2N6O2P — CID 143908204
1-[3-[7-[(1Z,3E)-1,4-diamino-4-methoxybuta-1,3-dienyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2-difluoro-2-phosphanylethyl)urea (PubChem CID 143908204) has the molecular formula C21H23F2N6O2P and a molecular weight of 460.43 g/mol. Its IUPAC name is 1-[3-[7-[(1Z,3E)-1,4-diamino-4-methoxybuta-1,3-dienyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2-difluoro-2-phosphanylethyl)urea.
| Compound Name | 1-[3-[7-[(1Z,3E)-1,4-diamino-4-methoxybuta-1,3-dienyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2-difluoro-2-phosphanylethyl)urea |
|---|---|
| PubChem CID | 143908204 |
| Molecular Formula | C21H23F2N6O2P |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 1-[3-[7-[(1Z,3E)-1,4-diamino-4-methoxybuta-1,3-dienyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2-difluoro-2-phosphanylethyl)urea |
| SMILES | CO/C(N)=C/C=C(\N)c1ccn2c(-c3cccc(NC(=O)NCC(F)(F)P)c3)cnc2c1 |
| InChI | InChI=1S/C21H23F2N6O2P/c1-31-18(25)6-5-16(24)13-7-8-29-17(11-26-19(29)10-13)14-3-2-4-15(9-14)28-20(30)27-12-21(22,23)32/h2-11H,12,24-25,32H2,1H3,(H2,27,28,30)/b16-5-,18-6+ |
| InChIKey | UFMCSDYHFOJFGP-WSAZBVPLSA-N |
| XLogP | 3.34 |
| TPSA | 119.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|