C7H9N — CID 143707484
N-(4-methylpenta-1,2,4-trienyl)methanimine (PubChem CID 143707484) has the molecular formula C7H9N and a molecular weight of 107.16 g/mol. Its IUPAC name is N-(4-methylpenta-1,2,4-trienyl)methanimine.
| Compound Name | N-(4-methylpenta-1,2,4-trienyl)methanimine |
|---|---|
| PubChem CID | 143707484 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | N-(4-methylpenta-1,2,4-trienyl)methanimine |
| SMILES | C=NC=C=CC(=C)C |
| InChI | InChI=1S/C7H9N/c1-7(2)5-4-6-8-3/h5-6H,1,3H2,2H3 |
| InChIKey | JJMDCOSKXJDJNY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|