About 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol
4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol (PubChem CID 143709828) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol |
| PubChem CID | 143709828 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol |
| SMILES | CC(N)C1=CC=C(C2(O)CCN(C)CC2)NC1 |
| InChI | InChI=1S/C13H23N3O/c1-10(14)11-3-4-12(15-9-11)13(17)5-7-16(2)8-6-13/h3-4,10,15,17H,5-9,14H2,1-2H3 |
| InChIKey | JJNYGBOAZDHBDF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol?
The IUPAC name of 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol (CID 143709828) is 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol.
What is the SMILES notation for 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol?
The canonical SMILES for 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol is CC(N)C1=CC=C(C2(O)CCN(C)CC2)NC1.
What is the InChIKey of 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol?
The InChIKey is JJNYGBOAZDHBDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O/c1-10(14)11-3-4-12(15-9-11)13(17)5-7-16(2)8-6-13/h3-4,10,15,17H,5-9,14H2,1-2H3.
What are the key properties of 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol?
4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol has a molecular weight of 237.35 g/mol, XLogP of 0.20, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1-aminoethyl)-1,2-dihydropyridin-6-yl]-1-methylpiperidin-4-ol is sourced from PubChem (CID 143709828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).