C29H31NO5 — CID 143710212
(4S)-4-[(4-benzhydrylbenzoyl)amino]-5-(2-methylpropoxy)-5-oxopentanoic acid (PubChem CID 143710212) has the molecular formula C29H31NO5 and a molecular weight of 473.57 g/mol. Its IUPAC name is (4S)-4-[(4-benzhydrylbenzoyl)amino]-5-(2-methylpropoxy)-5-oxopentanoic acid.
| Compound Name | (4S)-4-[(4-benzhydrylbenzoyl)amino]-5-(2-methylpropoxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 143710212 |
| Molecular Formula | C29H31NO5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (4S)-4-[(4-benzhydrylbenzoyl)amino]-5-(2-methylpropoxy)-5-oxopentanoic acid |
| SMILES | CC(C)COC(=O)[C@H](CCC(=O)O)NC(=O)c1ccc(C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H31NO5/c1-20(2)19-35-29(34)25(17-18-26(31)32)30-28(33)24-15-13-23(14-16-24)27(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-16,20,25,27H,17-19H2,1-2H3,(H,30,33)(H,31,32)/t25-/m0/s1 |
| InChIKey | BPJHGGNVIVSCRI-VWLOTQADSA-N |
| XLogP | 5.03 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|