C12H22N2 — CID 143713153
ethene;N-ethyl-N',2-dimethylhexa-3,5-dienimidamide (PubChem CID 143713153) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is ethene;N-ethyl-N',2-dimethylhexa-3,5-dienimidamide.
| Compound Name | ethene;N-ethyl-N',2-dimethylhexa-3,5-dienimidamide |
|---|---|
| PubChem CID | 143713153 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | ethene;N-ethyl-N',2-dimethylhexa-3,5-dienimidamide |
| SMILES | C=C.C=CC=CC(C)/C(=N/C)NCC |
| InChI | InChI=1S/C10H18N2.C2H4/c1-5-7-8-9(3)10(11-4)12-6-2;1-2/h5,7-9H,1,6H2,2-4H3,(H,11,12);1-2H2 |
| InChIKey | LZPNWOOWEUYWKN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|