C10H18N2 — CID 143713154
N-ethyl-N',2-dimethylhexa-3,5-dienimidamide (PubChem CID 143713154) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N-ethyl-N',2-dimethylhexa-3,5-dienimidamide.
| Compound Name | N-ethyl-N',2-dimethylhexa-3,5-dienimidamide |
|---|---|
| PubChem CID | 143713154 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-ethyl-N',2-dimethylhexa-3,5-dienimidamide |
| SMILES | C=CC=CC(C)/C(=N/C)NCC |
| InChI | InChI=1S/C10H18N2/c1-5-7-8-9(3)10(11-4)12-6-2/h5,7-9H,1,6H2,2-4H3,(H,11,12) |
| InChIKey | RGKMOLZTFPFUMN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|