C11H8Cl2N2O — CID 14371423
(1-aminopyrrol-2-yl)-(2,4-dichlorophenyl)methanone (PubChem CID 14371423) has the molecular formula C11H8Cl2N2O and a molecular weight of 255.10 g/mol. Its IUPAC name is (1-aminopyrrol-2-yl)-(2,4-dichlorophenyl)methanone.
| Compound Name | (1-aminopyrrol-2-yl)-(2,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 14371423 |
| Molecular Formula | C11H8Cl2N2O |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | (1-aminopyrrol-2-yl)-(2,4-dichlorophenyl)methanone |
| SMILES | Nn1cccc1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H8Cl2N2O/c12-7-3-4-8(9(13)6-7)11(16)10-2-1-5-15(10)14/h1-6H,14H2 |
| InChIKey | IBSMDSGDXZRZOP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |