C10H15N3 — CID 143715542
ethane;4-methyl-6H-pyrimido[1,6-a]pyrimidine (PubChem CID 143715542) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is ethane;4-methyl-6H-pyrimido[1,6-a]pyrimidine.
| Compound Name | ethane;4-methyl-6H-pyrimido[1,6-a]pyrimidine |
|---|---|
| PubChem CID | 143715542 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | ethane;4-methyl-6H-pyrimido[1,6-a]pyrimidine |
| SMILES | CC.CC1=CC=NC2=CC=NCN12 |
| InChI | InChI=1S/C8H9N3.C2H6/c1-7-2-5-10-8-3-4-9-6-11(7)8;1-2/h2-5H,6H2,1H3;1-2H3 |
| InChIKey | JXAQLTHSFGIPKK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |