About 2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene
2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene (PubChem CID 143716556) has the molecular formula C14H24S2
and a molecular weight of 256.48 g/mol. Its IUPAC name is 2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene.
Analyze 2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene?
The IUPAC name of 2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene (CID 143716556) is 2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene.
What is the SMILES notation for 2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene?
The canonical SMILES for 2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene is CC1CCCCCCCCC2=C1SCCS2.
What is the InChIKey of 2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene?
The InChIKey is MCSSIYPEUDXDOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24S2/c1-12-8-6-4-2-3-5-7-9-13-14(12)16-11-10-15-13/h12H,2-11H2,1H3.
What are the key properties of 2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene?
2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene has a molecular weight of 256.48 g/mol, XLogP of 5.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-12,15-dithiabicyclo[9.4.0]pentadec-1(11)-ene is sourced from PubChem (CID 143716556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).