C26H31N7O2 — CID 143716933
2-methanimidoyl-4-(methylaminomethyl)aniline;N-methylethanamine;2-pyridin-2-ylimidazo[1,2-a]pyridine-3,8-dicarbaldehyde (PubChem CID 143716933) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 2-methanimidoyl-4-(methylaminomethyl)aniline;N-methylethanamine;2-pyridin-2-ylimidazo[1,2-a]pyridine-3,8-dicarbaldehyde.
| Compound Name | 2-methanimidoyl-4-(methylaminomethyl)aniline;N-methylethanamine;2-pyridin-2-ylimidazo[1,2-a]pyridine-3,8-dicarbaldehyde |
|---|---|
| PubChem CID | 143716933 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 2-methanimidoyl-4-(methylaminomethyl)aniline;N-methylethanamine;2-pyridin-2-ylimidazo[1,2-a]pyridine-3,8-dicarbaldehyde |
| SMILES | CCNC.O=Cc1cccn2c(C=O)c(-c3ccccn3)nc12.[H]/N=C/c1cc(CNC)ccc1N |
| InChI | InChI=1S/C14H9N3O2.C9H13N3.C3H9N/c18-8-10-4-3-7-17-12(9-19)13(16-14(10)17)11-5-1-2-6-15-11;1-12-6-7-2-3-9(11)8(4-7)5-10;1-3-4-2/h1-9H;2-5,10,12H,6,11H2,1H3;4H,3H2,1-2H3/b;10-5+; |
| InChIKey | PRAFEBVOJXKZLU-ATWZUJJXSA-N |
| XLogP | 3.23 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|